Products 178765-55-4
CAS 178765-55-4 appears in our catalog under these names: 12-Hydroxyisobakuchiol, 12-Hydroxyisobakuchiol, 98.74%. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, 5 mg, 25 mg, 1 mg, 10 mg.
4-[(1E,3S)-3-ethenyl-6-hydroxy-3,7-dimethylocta-1,7-dienyl]phenol (CAS 178765-55-4) is a chemical compound with the molecular formula C18H24O2 and a molecular weight of 272.4 g/mol. IUPAC name: 4-[(1E,3S)-3-ethenyl-6-hydroxy-3,7-dimethylocta-1,7-dienyl]phenol. InChIKey: GWTVXRIOJRNDCM-UGFQGZRZSA-N.
| Molecular formula | C18H24O2 |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | 4-[(1E,3S)-3-ethenyl-6-hydroxy-3,7-dimethylocta-1,7-dienyl]phenol |
| InChIKey | GWTVXRIOJRNDCM-UGFQGZRZSA-N |
| SMILES | CC(=C)C(CC[C@@](C)(C=C)/C=C/C1=CC=C(C=C1)O)O |
Computed by PubChem (NCBI)