CAS 1788054-66-9 appears in our catalog under these names: 4-Chloro-2-iodo-7-methyl-7h-pyrrolo[2,3-b]pyridine, 95%, 4-chloro-2-iodo-7-methyl-7h-pyrrolo(2,3-b)pyridine, 97%, 4-chloro-2-iodo-7-methyl-7h-pyrrolo[2,3-b]pyridine, 97%, 97%, 4-chloro-2-iodo-7-methyl-7h-pyrrolo[2,3-b]pyridine, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 500mg, 10g, 5g, 100mg, 250mg, 1g.
4-chloro-2-iodo-7-methylpyrrolo[2,3-b]pyridine (CAS 1788054-66-9) is a chemical compound with the molecular formula C8H6ClIN2 and a molecular weight of 292.50 g/mol. IUPAC name: 4-chloro-2-iodo-7-methylpyrrolo[2,3-b]pyridine. InChIKey: JARBWCUJUPXCET-UHFFFAOYSA-N.
| Molecular formula | C8H6ClIN2 |
|---|---|
| Molecular weight | 292.50 g/mol |
| IUPAC name | 4-chloro-2-iodo-7-methylpyrrolo[2,3-b]pyridine |
| InChIKey | JARBWCUJUPXCET-UHFFFAOYSA-N |
| SMILES | CN1C=CC(=C2C1=NC(=C2)I)Cl |
Computed by PubChem (NCBI)