Products 1935106-50-5

CAS 1935106-50-5 is the registry number for 6-Chloro-3-iodo-2-methylimidazo[1,2-a]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

6-chloro-3-iodo-2-methylimidazo[1,2-a]pyridine (CAS 1935106-50-5) is a chemical compound with the molecular formula C8H6ClIN2 and a molecular weight of 292.50 g/mol. IUPAC name: 6-chloro-3-iodo-2-methylimidazo[1,2-a]pyridine. InChIKey: USWMXASNAGGDSR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClIN2
Molecular weight292.50 g/mol
IUPAC name6-chloro-3-iodo-2-methylimidazo[1,2-a]pyridine
InChIKeyUSWMXASNAGGDSR-UHFFFAOYSA-N
SMILESCC1=C(N2C=C(C=CC2=N1)Cl)I

Computed by PubChem (NCBI)