CAS 2767307-59-3 is the registry number for 5-Chloro-2-iodo-1-methyl-1H-pyrrolo[2,3-c]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-2-iodo-1-methylpyrrolo[2,3-c]pyridine (CAS 2767307-59-3) is a chemical compound with the molecular formula C8H6ClIN2 and a molecular weight of 292.50 g/mol. IUPAC name: 5-chloro-2-iodo-1-methylpyrrolo[2,3-c]pyridine. InChIKey: NOAJJQZWFNSFAS-UHFFFAOYSA-N.
| Molecular formula | C8H6ClIN2 |
|---|---|
| Molecular weight | 292.50 g/mol |
| IUPAC name | 5-chloro-2-iodo-1-methylpyrrolo[2,3-c]pyridine |
| InChIKey | NOAJJQZWFNSFAS-UHFFFAOYSA-N |
| SMILES | CN1C(=CC2=CC(=NC=C21)Cl)I |
Computed by PubChem (NCBI)