CAS 1936134-68-7 appears in our catalog under these names: 6-chloro-3-iodo-2-methyl-1H-pyrrolo(2,3-b)pyridine, 98%, 6-chloro-3-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg, 5g.
6-chloro-3-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine (CAS 1936134-68-7) is a chemical compound with the molecular formula C8H6ClIN2 and a molecular weight of 292.50 g/mol. IUPAC name: 6-chloro-3-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine. InChIKey: BQIJVOANSZTUNK-UHFFFAOYSA-N.
| Molecular formula | C8H6ClIN2 |
|---|---|
| Molecular weight | 292.50 g/mol |
| IUPAC name | 6-chloro-3-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | BQIJVOANSZTUNK-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)N=C(C=C2)Cl)I |
Computed by PubChem (NCBI)