CAS 1788054-70-5 is the registry number for (1-Methyl-1h-pyrazolo[3,4-b]pyridin-3-yl)methanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(1-methylpyrazolo[3,4-b]pyridin-3-yl)methanamine;hydrochloride (CAS 1788054-70-5) is a chemical compound with the molecular formula C8H11ClN4 and a molecular weight of 198.65 g/mol. IUPAC name: (1-methylpyrazolo[3,4-b]pyridin-3-yl)methanamine;hydrochloride. InChIKey: VKEOPIMHKBQENM-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN4 |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | (1-methylpyrazolo[3,4-b]pyridin-3-yl)methanamine;hydrochloride |
| InChIKey | VKEOPIMHKBQENM-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC=N2)C(=N1)CN.Cl |
Computed by PubChem (NCBI)