CAS 2065250-67-9 is the registry number for 1-Methyl-1h-indazole-3,5-diamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-methylindazole-3,5-diamine;hydrochloride (CAS 2065250-67-9) is a chemical compound with the molecular formula C8H11ClN4 and a molecular weight of 198.65 g/mol. IUPAC name: 1-methylindazole-3,5-diamine;hydrochloride. InChIKey: FJDZDKNWDJFDEH-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN4 |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 1-methylindazole-3,5-diamine;hydrochloride |
| InChIKey | FJDZDKNWDJFDEH-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)N)C(=N1)N.Cl |
Computed by PubChem (NCBI)