CAS 1956377-48-2 is the registry number for 1-[1,2,4]Triazolo[4,3-a]pyridin-3-yl-ethylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine;hydrochloride (CAS 1956377-48-2) is a chemical compound with the molecular formula C8H11ClN4 and a molecular weight of 198.65 g/mol. IUPAC name: 1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine;hydrochloride. InChIKey: ZXYVDNSPIIYLHT-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN4 |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine;hydrochloride |
| InChIKey | ZXYVDNSPIIYLHT-UHFFFAOYSA-N |
| SMILES | CC(C1=NN=C2N1C=CC=C2)N.Cl |
Computed by PubChem (NCBI)