CAS 84445-51-2 appears in our catalog under these names: 2–Chloro–5–(1–piperazinyl)pyrazine, 2-Chloro-5-(1-piperazinyl)pyrazine, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
2-chloro-5-piperazin-1-ylpyrazine (CAS 84445-51-2) is a chemical compound with the molecular formula C8H11ClN4 and a molecular weight of 198.65 g/mol. IUPAC name: 2-chloro-5-piperazin-1-ylpyrazine. InChIKey: OSJKCMGMSLEDMO-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN4 |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 2-chloro-5-piperazin-1-ylpyrazine |
| InChIKey | OSJKCMGMSLEDMO-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CN=C(C=N2)Cl |
Computed by PubChem (NCBI)