Products 17916-60-8
CAS 17916-60-8 appears in our catalog under these names: (E)–3–(4–bromophenyl)acrylic acid, (E)-3-(4-Bromophenyl)acrylic acid 98%, (E)-3-(4-bromophenyl)acrylic acid, 98%, 98%, (E)-3-(4-Bromophenyl)acrylic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 1g, 5g, 10g, 25g.
(E)-3-(4-bromophenyl)prop-2-enoic acid (CAS 17916-60-8) is a chemical compound with the molecular formula C9H7BrO2 and a molecular weight of 227.05 g/mol. IUPAC name: (E)-3-(4-bromophenyl)prop-2-enoic acid. InChIKey: CPDDDTNAMBSPRN-ZZXKWVIFSA-N.
| Molecular formula | C9H7BrO2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | (E)-3-(4-bromophenyl)prop-2-enoic acid |
| InChIKey | CPDDDTNAMBSPRN-ZZXKWVIFSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)O)Br |
Computed by PubChem (NCBI)
Synonyms:
(2E)-3-(4-bromophenyl)prop-2-enoic acid, 4-Bromocinnamic acid, (E)-3-(4-bromophenyl)acrylic acid, 3-(4-bromophenyl)acrylic acid, trans-4-Bromocinnamic acid, 2-Propenoic acid, 3-(4-bromophenyl)-, (2E)-, (E)-3-(4-bromophenyl)prop-2-enoic acid, C9H7BrO2, 4-Bromocinnamic acid, predominantly trans, p-Bromzimtsaure