Products 1794789-90-4
CAS 1794789-90-4 appears in our catalog under these names: Vanillin (o-methoxy-13C-d3), Vanillin-13C-d3, Vanillin-13C,d3. Offered by: Chemat Brand, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1 mg.
4-hydroxy-3-(trideuterio(113C)methoxy)benzaldehyde (CAS 1794789-90-4) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 156.16 g/mol. IUPAC name: 4-hydroxy-3-(trideuterio(113C)methoxy)benzaldehyde. InChIKey: MWOOGOJBHIARFG-KQORAOOSSA-N.
| Molecular formula | C8H8O3 |
|---|---|
| Molecular weight | 156.16 g/mol |
| IUPAC name | 4-hydroxy-3-(trideuterio(113C)methoxy)benzaldehyde |
| InChIKey | MWOOGOJBHIARFG-KQORAOOSSA-N |
| SMILES | [2H][13C]([2H])([2H])OC1=C(C=CC(=C1)C=O)O |
Computed by PubChem (NCBI)