CAS 201595-58-6 appears in our catalog under these names: Vanillin-13C6, Vanillin-13C6, 99.0%. Offered by: Chemat Brand, TRC, Chemat, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5 mg, 10 mg, 1 mg.
4-hydroxy-3-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbaldehyde (CAS 201595-58-6) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 158.10 g/mol. IUPAC name: 4-hydroxy-3-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbaldehyde. InChIKey: MWOOGOJBHIARFG-BOCFXHSMSA-N.
| Molecular formula | C8H8O3 |
|---|---|
| Molecular weight | 158.10 g/mol |
| IUPAC name | 4-hydroxy-3-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbaldehyde |
| InChIKey | MWOOGOJBHIARFG-BOCFXHSMSA-N |
| SMILES | CO[13C]1=[13C]([13CH]=[13CH][13C](=[13CH]1)C=O)O |
Computed by PubChem (NCBI)