CAS 63057-71-6 appears in our catalog under these names: Vanillin-alpha-13C, Vanillin-13C. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
4-hydroxy-3-methoxy(13C)benzaldehyde (CAS 63057-71-6) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 153.14 g/mol. IUPAC name: 4-hydroxy-3-methoxy(13C)benzaldehyde. InChIKey: MWOOGOJBHIARFG-HOSYLAQJSA-N.
| Molecular formula | C8H8O3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 4-hydroxy-3-methoxy(13C)benzaldehyde |
| InChIKey | MWOOGOJBHIARFG-HOSYLAQJSA-N |
| SMILES | COC1=C(C=CC(=C1)[13CH]=O)O |
Computed by PubChem (NCBI)