Products 1794793-34-2
CAS 1794793-34-2 is the registry number for 2–(4–Amino–1，3，5–triazin–2–yl)sulfanylethanesulfonic Acid–d4. Offered by: GLPBio. Available pack sizes: 10mg.
2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]-1,1,2,2-tetradeuterioethanesulfonic acid (CAS 1794793-34-2) is a chemical compound with the molecular formula C5H8N4O3S2 and a molecular weight of 240.3 g/mol. IUPAC name: 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]-1,1,2,2-tetradeuterioethanesulfonic acid. InChIKey: ICGPQDWXRMFMCX-LNLMKGTHSA-N.
| Molecular formula | C5H8N4O3S2 |
|---|---|
| Molecular weight | 240.3 g/mol |
| IUPAC name | 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]-1,1,2,2-tetradeuterioethanesulfonic acid |
| InChIKey | ICGPQDWXRMFMCX-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])S(=O)(=O)O)SC1=NC=NC(=N1)N |
Computed by PubChem (NCBI)