CAS 1794810-75-5 is the registry number for MBDB–d3 (hydrochloride). Offered by: GLPBio. Available pack sizes: 1mg, 500μg.
1-(1,3-benzodioxol-5-yl)-N-(trideuteriomethyl)butan-2-amine;hydrochloride (CAS 1794810-75-5) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 246.75 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-N-(trideuteriomethyl)butan-2-amine;hydrochloride. InChIKey: LFXXIXAVEJVYGY-MUTAZJQDSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 246.75 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-N-(trideuteriomethyl)butan-2-amine;hydrochloride |
| InChIKey | LFXXIXAVEJVYGY-MUTAZJQDSA-N |
| SMILES | [2H]C([2H])([2H])NC(CC)CC1=CC2=C(C=C1)OCO2.Cl |
Computed by PubChem (NCBI)