Products 1794884-85-7
CAS 1794884-85-7 appears in our catalog under these names: Allobarbital-d10 (1mg/ml in Methanol), Allobarbital-d10, >95% (HPLC), Allobarbital–d10. Offered by: TRC, GLPBio. Available pack sizes: 1x1ml, 10mg, 1mg.
5,5-bis(1,1,2,3,3-pentadeuterioprop-2-enyl)-1,3-diazinane-2,4,6-trione (CAS 1794884-85-7) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 218.27 g/mol. IUPAC name: 5,5-bis(1,1,2,3,3-pentadeuterioprop-2-enyl)-1,3-diazinane-2,4,6-trione. InChIKey: FDQGNLOWMMVRQL-URTNXKOFSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | 5,5-bis(1,1,2,3,3-pentadeuterioprop-2-enyl)-1,3-diazinane-2,4,6-trione |
| InChIKey | FDQGNLOWMMVRQL-URTNXKOFSA-N |
| SMILES | [2H]C(=C([2H])C([2H])([2H])C1(C(=O)NC(=O)NC1=O)C([2H])([2H])C(=C([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)