CAS 1794941-48-2 is the registry number for Chrysoeriol-d3. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 5mg, 10mg, 50mg.
5,7-dihydroxy-2-[4-hydroxy-3-(trideuteriomethoxy)phenyl]chromen-4-one (CAS 1794941-48-2) is a chemical compound with the molecular formula C16H12O6 and a molecular weight of 303.28 g/mol. IUPAC name: 5,7-dihydroxy-2-[4-hydroxy-3-(trideuteriomethoxy)phenyl]chromen-4-one. InChIKey: SCZVLDHREVKTSH-FIBGUPNXSA-N.
| Molecular formula | C16H12O6 |
|---|---|
| Molecular weight | 303.28 g/mol |
| IUPAC name | 5,7-dihydroxy-2-[4-hydroxy-3-(trideuteriomethoxy)phenyl]chromen-4-one |
| InChIKey | SCZVLDHREVKTSH-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O |
Computed by PubChem (NCBI)