CAS 1794979-77-3 is the registry number for N-Desisopropyl Metoprolol-d5, >95% (HPLC). Offered by: TRC. Available pack sizes: 25mg, 50mg, 5mg.
1-amino-1,1,2,3,3-pentadeuterio-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol (CAS 1794979-77-3) is a chemical compound with the molecular formula C12H19NO3 and a molecular weight of 230.31 g/mol. IUPAC name: 1-amino-1,1,2,3,3-pentadeuterio-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol. InChIKey: XJWXVDJGNOHFLR-QJHRKUAUSA-N.
| Molecular formula | C12H19NO3 |
|---|---|
| Molecular weight | 230.31 g/mol |
| IUPAC name | 1-amino-1,1,2,3,3-pentadeuterio-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol |
| InChIKey | XJWXVDJGNOHFLR-QJHRKUAUSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])OC1=CC=C(C=C1)CCOC)O)N |
Computed by PubChem (NCBI)