Products 1795027-87-0
CAS 1795027-87-0 appears in our catalog under these names: N-Benzyl Epinephrine-d3, N–Benzyl Epinephrine–d3. Offered by: TRC, GLPBio. Available pack sizes: 50mg, 5mg, 100mg.
4-[2-[benzyl(trideuteriomethyl)amino]-1-hydroxyethyl]benzene-1,2-diol (CAS 1795027-87-0) is a chemical compound with the molecular formula C16H19NO3 and a molecular weight of 276.34 g/mol. IUPAC name: 4-[2-[benzyl(trideuteriomethyl)amino]-1-hydroxyethyl]benzene-1,2-diol. InChIKey: YENHZTNWVCNPRW-FIBGUPNXSA-N.
| Molecular formula | C16H19NO3 |
|---|---|
| Molecular weight | 276.34 g/mol |
| IUPAC name | 4-[2-[benzyl(trideuteriomethyl)amino]-1-hydroxyethyl]benzene-1,2-diol |
| InChIKey | YENHZTNWVCNPRW-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N(CC1=CC=CC=C1)CC(C2=CC(=C(C=C2)O)O)O |
Computed by PubChem (NCBI)