CAS 317351-40-9 appears in our catalog under these names: Adrenaline EP Impurity D, 4-((1R)-1-Hydroxy-2-(methyl(phenylmethyl)amino)ethyl)-1,2-benzenediol, >95% (HPLC), N-BENZYL EPINEPHRINE. Offered by: Chemat Brand, TRC, Sigma-Aldrich. Available pack sizes: on request, 10mg, 1mg, 5mg, 25MG.
4-[(1R)-2-[benzyl(methyl)amino]-1-hydroxyethyl]benzene-1,2-diol (CAS 317351-40-9) is a chemical compound with the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. IUPAC name: 4-[(1R)-2-[benzyl(methyl)amino]-1-hydroxyethyl]benzene-1,2-diol. InChIKey: YENHZTNWVCNPRW-INIZCTEOSA-N.
| Molecular formula | C16H19NO3 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 4-[(1R)-2-[benzyl(methyl)amino]-1-hydroxyethyl]benzene-1,2-diol |
| InChIKey | YENHZTNWVCNPRW-INIZCTEOSA-N |
| SMILES | CN(CC1=CC=CC=C1)C[C@@H](C2=CC(=C(C=C2)O)O)O |
Computed by PubChem (NCBI)