Products 179691-31-7

CAS 179691-31-7 is the registry number for 2-(2-Nitrophenyl)propyl carbonochloridate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

2-(2-nitrophenyl)propyl carbonochloridate (CAS 179691-31-7) is a chemical compound with the molecular formula C10H10ClNO4 and a molecular weight of 243.64 g/mol. IUPAC name: 2-(2-nitrophenyl)propyl carbonochloridate. InChIKey: LRWLGGPRIFYAPO-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10ClNO4
Molecular weight243.64 g/mol
IUPAC name2-(2-nitrophenyl)propyl carbonochloridate
InChIKeyLRWLGGPRIFYAPO-UHFFFAOYSA-N
SMILESCC(COC(=O)Cl)C1=CC=CC=C1[N+](=O)[O-]

Computed by PubChem (NCBI)