Products 1797209-64-3
CAS 1797209-64-3 is the registry number for tert-butyl 2-methylpyridin-3-yl carbonate, 95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl (2-methyl-3-pyridinyl) carbonate (CAS 1797209-64-3) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: tert-butyl (2-methyl-3-pyridinyl) carbonate. InChIKey: RZJUDYPSWRQSPU-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | tert-butyl (2-methyl-3-pyridinyl) carbonate |
| InChIKey | RZJUDYPSWRQSPU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=N1)OC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)