CAS 1797884-06-0 is the registry number for Methyl-2-chloroquinazoline-4-carboxylate. Offered by: TRC. Available pack sizes: 1g.
Methyl 2-chloroquinazoline-4-carboxylate (CAS 1797884-06-0) is a chemical compound with the molecular formula C10H7ClN2O2 and a molecular weight of 222.63 g/mol. IUPAC name: methyl 2-chloroquinazoline-4-carboxylate. InChIKey: UWFJIYLQUPOOJI-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2 |
|---|---|
| Molecular weight | 222.63 g/mol |
| IUPAC name | methyl 2-chloroquinazoline-4-carboxylate |
| InChIKey | UWFJIYLQUPOOJI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=NC2=CC=CC=C21)Cl |
Computed by PubChem (NCBI)