CAS 1797884-10-6 is the registry number for 2,3-Methylenedioxymethcathinone Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
1-(1,3-benzodioxol-4-yl)-2-(methylamino)propan-1-one;hydrochloride (CAS 1797884-10-6) is a chemical compound with the molecular formula C11H14ClNO3 and a molecular weight of 243.68 g/mol. IUPAC name: 1-(1,3-benzodioxol-4-yl)-2-(methylamino)propan-1-one;hydrochloride. InChIKey: VDEXNJVGLIHORH-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO3 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-4-yl)-2-(methylamino)propan-1-one;hydrochloride |
| InChIKey | VDEXNJVGLIHORH-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=C2C(=CC=C1)OCO2)NC.Cl |
Computed by PubChem (NCBI)