CAS 1797888-79-9 appears in our catalog under these names: 7-Bromo-3,3,4-trimethyl-2,3-dihydro-1H-indole hydrochloride, 95%, 7-Bromo-3,3,4-trimethyl-2,3-dihydro-1H-indole hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
7-bromo-3,3,4-trimethyl-1,2-dihydroindole;hydrochloride (CAS 1797888-79-9) is a chemical compound with the molecular formula C11H15BrClN and a molecular weight of 276.60 g/mol. IUPAC name: 7-bromo-3,3,4-trimethyl-1,2-dihydroindole;hydrochloride. InChIKey: RSIKWTAXMLJQDP-UHFFFAOYSA-N.
| Molecular formula | C11H15BrClN |
|---|---|
| Molecular weight | 276.60 g/mol |
| IUPAC name | 7-bromo-3,3,4-trimethyl-1,2-dihydroindole;hydrochloride |
| InChIKey | RSIKWTAXMLJQDP-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)Br)NCC2(C)C.Cl |
Computed by PubChem (NCBI)