CAS 1797894-62-2 appears in our catalog under these names: 4-(Dibromomethyl)-(1,1-biphenyl)-2-carboxylic acid, Telmisartan Dibromo Acid Impurity (4’,4’-Dibromomethyl Biphenyl-2-Carboxylic Acid), Telmisartan Impurity 1, 4'-(Dibromomethyl)-(1,1'-biphenyl)-2-carboxylic Acid (Telmisartan Impurity). Offered by: Biosynth, Chemat Brand, TRC. Available pack sizes: 1000mg, on request, 100mg, 1g.
2-[4-(dibromomethyl)phenyl]benzoic acid (CAS 1797894-62-2) is a chemical compound with the molecular formula C14H10Br2O2 and a molecular weight of 370.03 g/mol. IUPAC name: 2-[4-(dibromomethyl)phenyl]benzoic acid. InChIKey: ZHWNQZNXYWCFCX-UHFFFAOYSA-N.
| Molecular formula | C14H10Br2O2 |
|---|---|
| Molecular weight | 370.03 g/mol |
| IUPAC name | 2-[4-(dibromomethyl)phenyl]benzoic acid |
| InChIKey | ZHWNQZNXYWCFCX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)C(Br)Br)C(=O)O |
Computed by PubChem (NCBI)