CAS 663180-98-1 appears in our catalog under these names: Methyl 3',5'-dibromo-[1,1'-biphenyl]-4-carboxylate 95%, Methyl 3',5'-dibromo-[1,1'-biphenyl]-4-carboxylate, 95%, 95%, Methyl 3,5-dibromo-[1,1-biphenyl]-4-carboxylate, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 4-(3,5-dibromophenyl)benzoate (CAS 663180-98-1) is a chemical compound with the molecular formula C14H10Br2O2 and a molecular weight of 370.03 g/mol. IUPAC name: methyl 4-(3,5-dibromophenyl)benzoate. InChIKey: OEYLMTMPBDXWIO-UHFFFAOYSA-N.
| Molecular formula | C14H10Br2O2 |
|---|---|
| Molecular weight | 370.03 g/mol |
| IUPAC name | methyl 4-(3,5-dibromophenyl)benzoate |
| InChIKey | OEYLMTMPBDXWIO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC(=CC(=C2)Br)Br |
Computed by PubChem (NCBI)