CAS 61657-63-4 appears in our catalog under these names: 2-(Benzyloxy)-3,5-dibromobenzaldehyde, 95%, 2-(benzyloxy)-3,5-dibromobenzaldehyde, 2-(Benzyloxy)-3,5-dibromobenzaldehyde, 97%, 97%, 2-(benzyloxy)-3,5-dibromobenzaldehyde, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g, 100mg.
3,5-dibromo-2-phenylmethoxybenzaldehyde (CAS 61657-63-4) is a chemical compound with the molecular formula C14H10Br2O2 and a molecular weight of 370.03 g/mol. IUPAC name: 3,5-dibromo-2-phenylmethoxybenzaldehyde. InChIKey: AACUFLFOQQDBBB-UHFFFAOYSA-N.
| Molecular formula | C14H10Br2O2 |
|---|---|
| Molecular weight | 370.03 g/mol |
| IUPAC name | 3,5-dibromo-2-phenylmethoxybenzaldehyde |
| InChIKey | AACUFLFOQQDBBB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2Br)Br)C=O |
Computed by PubChem (NCBI)