CAS 61592-98-1 is the registry number for 1,2–bis(2–bromophenyl)–2–hydroxyethanone. Offered by: GLPBio. Available pack sizes: 25g, 5g.
1,2-bis(2-bromophenyl)-2-hydroxyethanone (CAS 61592-98-1) is a chemical compound with the molecular formula C14H10Br2O2 and a molecular weight of 370.03 g/mol. IUPAC name: 1,2-bis(2-bromophenyl)-2-hydroxyethanone. InChIKey: OXKYIPSJQMUPSW-UHFFFAOYSA-N.
| Molecular formula | C14H10Br2O2 |
|---|---|
| Molecular weight | 370.03 g/mol |
| IUPAC name | 1,2-bis(2-bromophenyl)-2-hydroxyethanone |
| InChIKey | OXKYIPSJQMUPSW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)C2=CC=CC=C2Br)O)Br |
Computed by PubChem (NCBI)