Products 1797987-05-3
CAS 1797987-05-3 is the registry number for 6-Amino-2-pyridinyl(2-quinolinyl)methanone. Offered by: TRC. Available pack sizes: 250mg.
(6-amino-2-pyridinyl)-quinolin-2-ylmethanone (CAS 1797987-05-3) is a chemical compound with the molecular formula C15H11N3O and a molecular weight of 249.27 g/mol. IUPAC name: (6-amino-2-pyridinyl)-quinolin-2-ylmethanone. InChIKey: RJGGHMQYQSFINL-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O |
|---|---|
| Molecular weight | 249.27 g/mol |
| IUPAC name | (6-amino-2-pyridinyl)-quinolin-2-ylmethanone |
| InChIKey | RJGGHMQYQSFINL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C(=O)C3=NC(=CC=C3)N |
Computed by PubChem (NCBI)