Products 1798397-11-1
CAS 1798397-11-1 is the registry number for (3,5-Dimethyl-2-hexeno)-4-hydroxyphenone. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 250mg.
1-(4-hydroxyphenyl)-3,5-dimethylhex-2-en-1-one (CAS 1798397-11-1) is a chemical compound with the molecular formula C14H18O2 and a molecular weight of 218.29 g/mol. IUPAC name: 1-(4-hydroxyphenyl)-3,5-dimethylhex-2-en-1-one. InChIKey: ZMBMORSEJUWTHM-UHFFFAOYSA-N.
| Molecular formula | C14H18O2 |
|---|---|
| Molecular weight | 218.29 g/mol |
| IUPAC name | 1-(4-hydroxyphenyl)-3,5-dimethylhex-2-en-1-one |
| InChIKey | ZMBMORSEJUWTHM-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=CC(=O)C1=CC=C(C=C1)O)C |
Computed by PubChem (NCBI)