CAS 1798732-53-2 appears in our catalog under these names: Methyl 2-(3-(aminomethyl)phenyl)-1,3-thiazole-4-carboxylate hydrobromide, 95%, Methyl 2-(3-(aminomethyl)phenyl)-1,3-thiazole-4-carboxylate hydrobromide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 2-[3-(aminomethyl)phenyl]-1,3-thiazole-4-carboxylate;hydrobromide (CAS 1798732-53-2) is a chemical compound with the molecular formula C12H13BrN2O2S and a molecular weight of 329.21 g/mol. IUPAC name: methyl 2-[3-(aminomethyl)phenyl]-1,3-thiazole-4-carboxylate;hydrobromide. InChIKey: YAMVSQGYPSYQLQ-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O2S |
|---|---|
| Molecular weight | 329.21 g/mol |
| IUPAC name | methyl 2-[3-(aminomethyl)phenyl]-1,3-thiazole-4-carboxylate;hydrobromide |
| InChIKey | YAMVSQGYPSYQLQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=N1)C2=CC=CC(=C2)CN.Br |
Computed by PubChem (NCBI)