CAS 1909271-44-8 is the registry number for 4-(6-Bromo-1H-benzo[d]imidazol-1-yl)tetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(6-bromobenzimidazol-1-yl)thiane 1,1-dioxide (CAS 1909271-44-8) is a chemical compound with the molecular formula C12H13BrN2O2S and a molecular weight of 329.21 g/mol. IUPAC name: 4-(6-bromobenzimidazol-1-yl)thiane 1,1-dioxide. InChIKey: KUGSAADDRXBDEW-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O2S |
|---|---|
| Molecular weight | 329.21 g/mol |
| IUPAC name | 4-(6-bromobenzimidazol-1-yl)thiane 1,1-dioxide |
| InChIKey | KUGSAADDRXBDEW-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1N2C=NC3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)