CAS 945400-88-4 is the registry number for tert-Butyl (2-bromobenzo(d)thiazol-6-yl)carbamate, 97%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl N-(2-bromo-1,3-benzothiazol-6-yl)carbamate (CAS 945400-88-4) is a chemical compound with the molecular formula C12H13BrN2O2S and a molecular weight of 329.21 g/mol. IUPAC name: tert-butyl N-(2-bromo-1,3-benzothiazol-6-yl)carbamate. InChIKey: FCURNPDMPRPJOD-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O2S |
|---|---|
| Molecular weight | 329.21 g/mol |
| IUPAC name | tert-butyl N-(2-bromo-1,3-benzothiazol-6-yl)carbamate |
| InChIKey | FCURNPDMPRPJOD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC2=C(C=C1)N=C(S2)Br |
Computed by PubChem (NCBI)