CAS 1823565-33-8 appears in our catalog under these names: (4–Bromo–benzothiazol–2–yl)–carbamic acid tert–butyl ester, (4-Bromobenzothiazol-2-yl)carbamic acid tert-butyl ester, 95%, 95%, (4-Bromo-benzothiazol-2-yl)-carbamic acid tert-butyl ester, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 500mg.
Tert-butyl N-(4-bromo-1,3-benzothiazol-2-yl)carbamate (CAS 1823565-33-8) is a chemical compound with the molecular formula C12H13BrN2O2S and a molecular weight of 329.21 g/mol. IUPAC name: tert-butyl N-(4-bromo-1,3-benzothiazol-2-yl)carbamate. InChIKey: VSHNMMQBTXSHJO-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O2S |
|---|---|
| Molecular weight | 329.21 g/mol |
| IUPAC name | tert-butyl N-(4-bromo-1,3-benzothiazol-2-yl)carbamate |
| InChIKey | VSHNMMQBTXSHJO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC2=C(S1)C=CC=C2Br |
Computed by PubChem (NCBI)