Products 1798842-76-8
CAS 1798842-76-8 is the registry number for Methyl 5-chloro-4-(trifluoromethyl)picolinate, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 5-chloro-4-(trifluoromethyl)pyridine-2-carboxylate (CAS 1798842-76-8) is a chemical compound with the molecular formula C8H5ClF3NO2 and a molecular weight of 239.58 g/mol. IUPAC name: methyl 5-chloro-4-(trifluoromethyl)pyridine-2-carboxylate. InChIKey: ZSOUZFPZYQVOLH-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO2 |
|---|---|
| Molecular weight | 239.58 g/mol |
| IUPAC name | methyl 5-chloro-4-(trifluoromethyl)pyridine-2-carboxylate |
| InChIKey | ZSOUZFPZYQVOLH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=C(C(=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)