Products 179899-07-1

CAS 179899-07-1 appears in our catalog under these names: 4–Fluoro–2–methoxyphenylboronic acid(contains varying amounts of Anhydride), 4-Fluoro-2-methoxyphenylboronic Acid (contains varying amounts of Anhydride), 4-Fluoro-2-methoxyphenylboronic acid 98%, 4-FLUORO-2-METHOXYPHENYLBORONIC ACID, 4-Fluoro-2-methoxyphenylboronic acid, 98%, 98%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 25g, 5g, 1g, 250mg, 10g, 100g, 50g.

Structural formula: {0} (CAS {1})

(4-fluoro-2-methoxyphenyl)boronic acid (CAS 179899-07-1) is a chemical compound with the molecular formula C7H8BFO3 and a molecular weight of 169.95 g/mol. IUPAC name: (4-fluoro-2-methoxyphenyl)boronic acid. InChIKey: ADJBXDCXYMCCAD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8BFO3
Molecular weight169.95 g/mol
IUPAC name(4-fluoro-2-methoxyphenyl)boronic acid
InChIKeyADJBXDCXYMCCAD-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1)F)OC)(O)O

Computed by PubChem (NCBI)