CAS 179912-34-6 appears in our catalog under these names: (6-Bromo-4-oxo-3,4-dihydroquinazolin-2-yl)acetonitrile, 95%, 2-(6-Bromo-4-oxo-3,4-dihydroquinazolin-2-yl)acetonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
2-(6-bromo-4-oxo-3H-quinazolin-2-yl)acetonitrile (CAS 179912-34-6) is a chemical compound with the molecular formula C10H6BrN3O and a molecular weight of 264.08 g/mol. IUPAC name: 2-(6-bromo-4-oxo-3H-quinazolin-2-yl)acetonitrile. InChIKey: SGSPRKJTAXCQDE-UHFFFAOYSA-N.
| Molecular formula | C10H6BrN3O |
|---|---|
| Molecular weight | 264.08 g/mol |
| IUPAC name | 2-(6-bromo-4-oxo-3H-quinazolin-2-yl)acetonitrile |
| InChIKey | SGSPRKJTAXCQDE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)NC(=N2)CC#N |
Computed by PubChem (NCBI)