CAS 866154-02-1 is the registry number for 5-Amino-3-(4-bromophenyl)isoxazole-4-carbonitrile, 90%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-amino-3-(4-bromophenyl)-1,2-oxazole-4-carbonitrile (CAS 866154-02-1) is a chemical compound with the molecular formula C10H6BrN3O and a molecular weight of 264.08 g/mol. IUPAC name: 5-amino-3-(4-bromophenyl)-1,2-oxazole-4-carbonitrile. InChIKey: UWJUIZTWTQMCPR-UHFFFAOYSA-N.
| Molecular formula | C10H6BrN3O |
|---|---|
| Molecular weight | 264.08 g/mol |
| IUPAC name | 5-amino-3-(4-bromophenyl)-1,2-oxazole-4-carbonitrile |
| InChIKey | UWJUIZTWTQMCPR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=C2C#N)N)Br |
Computed by PubChem (NCBI)