CAS 357647-51-9 is the registry number for 8-Bromoimidazo[1,5-a]quinoxalin-4(5H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-5H-imidazo[1,5-a]quinoxalin-4-one (CAS 357647-51-9) is a chemical compound with the molecular formula C10H6BrN3O and a molecular weight of 264.08 g/mol. IUPAC name: 8-bromo-5H-imidazo[1,5-a]quinoxalin-4-one. InChIKey: BCCJREJWEKWYHI-UHFFFAOYSA-N.
| Molecular formula | C10H6BrN3O |
|---|---|
| Molecular weight | 264.08 g/mol |
| IUPAC name | 8-bromo-5H-imidazo[1,5-a]quinoxalin-4-one |
| InChIKey | BCCJREJWEKWYHI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)N3C=NC=C3C(=O)N2 |
Computed by PubChem (NCBI)