CAS 937629-16-8 is the registry number for 2-(3-(4-Bromophenyl)-1,2,4-oxadiazol-5-yl)acetonitrile. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]acetonitrile (CAS 937629-16-8) is a chemical compound with the molecular formula C10H6BrN3O and a molecular weight of 264.08 g/mol. IUPAC name: 2-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]acetonitrile. InChIKey: VLCIWZOZDPHMGD-UHFFFAOYSA-N.
| Molecular formula | C10H6BrN3O |
|---|---|
| Molecular weight | 264.08 g/mol |
| IUPAC name | 2-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]acetonitrile |
| InChIKey | VLCIWZOZDPHMGD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)CC#N)Br |
Computed by PubChem (NCBI)