CAS 1800399-17-0 appears in our catalog under these names: 3-(Imino(methyl)oxo-lambda6-sulfanyl)benzoic acid, 98%, 3-(Methylsulfonimidoyl)benzoic acid, 3-(S-Methylsulfonimidoyl)benzoic acid, 97%. Offered by: AmBeed, Biosynth, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 0,5g, 100mg.
3-(methylsulfonimidoyl)benzoic acid (CAS 1800399-17-0) is a chemical compound with the molecular formula C8H9NO3S and a molecular weight of 199.23 g/mol. IUPAC name: 3-(methylsulfonimidoyl)benzoic acid. InChIKey: LUKGLCOJCPIZRG-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3S |
|---|---|
| Molecular weight | 199.23 g/mol |
| IUPAC name | 3-(methylsulfonimidoyl)benzoic acid |
| InChIKey | LUKGLCOJCPIZRG-UHFFFAOYSA-N |
| SMILES | CS(=N)(=O)C1=CC=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)