Products 180080-87-9
CAS 180080-87-9 appears in our catalog under these names: 1-(3-Nitrophenyl)cyclobutanecarboxylic acid, 95%, 1–(3–nitrophenyl)cyclobutanecarboxylic acid, 1-(3-Nitrophenyl)cyclobutanecarboxylic acid. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 50mg, 0,5g.
1-(3-nitrophenyl)cyclobutane-1-carboxylic acid (CAS 180080-87-9) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 1-(3-nitrophenyl)cyclobutane-1-carboxylic acid. InChIKey: QBUXPHKPYHXRST-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 1-(3-nitrophenyl)cyclobutane-1-carboxylic acid |
| InChIKey | QBUXPHKPYHXRST-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC(=CC=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)