CAS 1801335-00-1 is the registry number for 2-(4,6-Dichloropyridin-3-yl)propan-2-ol, 98%. Offered by: AmBeed. Available pack sizes: 1g.
2-(4,6-dichloro-3-pyridinyl)propan-2-ol (CAS 1801335-00-1) is a chemical compound with the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. IUPAC name: 2-(4,6-dichloro-3-pyridinyl)propan-2-ol. InChIKey: GTKLTAYQGIKYTN-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | 2-(4,6-dichloro-3-pyridinyl)propan-2-ol |
| InChIKey | GTKLTAYQGIKYTN-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CN=C(C=C1Cl)Cl)O |
Computed by PubChem (NCBI)