CAS 18018-09-2 appears in our catalog under these names: 1,3-Dichloro-2-methylanthraquinone, 95%, 1,3–Dichloro–2–methylanthracene–9,10–dione, 1,3-Dichloro-2-methylanthracene-9,10-dione, 95%, 1,3-Dichloro-2-methyl-9,10-anthracenedione, 95%, 95%. Offered by: Combi-blocks, GLPBio, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
1,3-dichloro-2-methylanthracene-9,10-dione (CAS 18018-09-2) is a chemical compound with the molecular formula C15H8Cl2O2 and a molecular weight of 291.1 g/mol. IUPAC name: 1,3-dichloro-2-methylanthracene-9,10-dione. InChIKey: QZKRKMRVWWGTRU-UHFFFAOYSA-N.
| Molecular formula | C15H8Cl2O2 |
|---|---|
| Molecular weight | 291.1 g/mol |
| IUPAC name | 1,3-dichloro-2-methylanthracene-9,10-dione |
| InChIKey | QZKRKMRVWWGTRU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C(=C1Cl)C(=O)C3=CC=CC=C3C2=O)Cl |
Computed by PubChem (NCBI)