CAS 58236-20-7 is the registry number for 6,7-Dichloroanthracene-1-carboxylic acid, 98+%. Offered by: AmBeed. Available pack sizes: 25g.
6,7-dichloroanthracene-1-carboxylic acid (CAS 58236-20-7) is a chemical compound with the molecular formula C15H8Cl2O2 and a molecular weight of 291.1 g/mol. IUPAC name: 6,7-dichloroanthracene-1-carboxylic acid. InChIKey: KNUSPCYZXSAADW-UHFFFAOYSA-N.
| Molecular formula | C15H8Cl2O2 |
|---|---|
| Molecular weight | 291.1 g/mol |
| IUPAC name | 6,7-dichloroanthracene-1-carboxylic acid |
| InChIKey | KNUSPCYZXSAADW-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC3=CC(=C(C=C3C=C2C(=C1)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)