CAS 55994-25-7 is the registry number for 2-(3,5-Dichlorophenyl)-1H-indene-1,3(2H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,5-dichlorophenyl)indene-1,3-dione (CAS 55994-25-7) is a chemical compound with the molecular formula C15H8Cl2O2 and a molecular weight of 291.1 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)indene-1,3-dione. InChIKey: ULIDNUZJNCYVSO-UHFFFAOYSA-N.
| Molecular formula | C15H8Cl2O2 |
|---|---|
| Molecular weight | 291.1 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)indene-1,3-dione |
| InChIKey | ULIDNUZJNCYVSO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(C2=O)C3=CC(=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)