CAS 69976-31-4 is the registry number for 3-(2’,4’-Dichlorophenyl)coumarin, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,4-dichlorophenyl)chromen-2-one (CAS 69976-31-4) is a chemical compound with the molecular formula C15H8Cl2O2 and a molecular weight of 291.1 g/mol. IUPAC name: 3-(2,4-dichlorophenyl)chromen-2-one. InChIKey: ODQMZVWOSDQHFP-UHFFFAOYSA-N.
| Molecular formula | C15H8Cl2O2 |
|---|---|
| Molecular weight | 291.1 g/mol |
| IUPAC name | 3-(2,4-dichlorophenyl)chromen-2-one |
| InChIKey | ODQMZVWOSDQHFP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=O)O2)C3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)