CAS 1801869-68-0 is the registry number for 1-Cyano-2-(trifluoromethyl)cyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-cyano-2-(trifluoromethyl)cyclopropane-1-carboxylic acid (CAS 1801869-68-0) is a chemical compound with the molecular formula C6H4F3NO2 and a molecular weight of 179.10 g/mol. IUPAC name: 1-cyano-2-(trifluoromethyl)cyclopropane-1-carboxylic acid. InChIKey: PKJHRVSFVVXNMT-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO2 |
|---|---|
| Molecular weight | 179.10 g/mol |
| IUPAC name | 1-cyano-2-(trifluoromethyl)cyclopropane-1-carboxylic acid |
| InChIKey | PKJHRVSFVVXNMT-UHFFFAOYSA-N |
| SMILES | C1C(C1(C#N)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)