Products 1801869-68-0

CAS 1801869-68-0 is the registry number for 1-Cyano-2-(trifluoromethyl)cyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1-cyano-2-(trifluoromethyl)cyclopropane-1-carboxylic acid (CAS 1801869-68-0) is a chemical compound with the molecular formula C6H4F3NO2 and a molecular weight of 179.10 g/mol. IUPAC name: 1-cyano-2-(trifluoromethyl)cyclopropane-1-carboxylic acid. InChIKey: PKJHRVSFVVXNMT-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4F3NO2
Molecular weight179.10 g/mol
IUPAC name1-cyano-2-(trifluoromethyl)cyclopropane-1-carboxylic acid
InChIKeyPKJHRVSFVVXNMT-UHFFFAOYSA-N
SMILESC1C(C1(C#N)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)