CAS 1802154-58-0 is the registry number for 4-Bromo-1-fluoro-2-naphthoic acid, 98%. Offered by: AmBeed. Available pack sizes: 10g.
4-bromo-1-fluoronaphthalene-2-carboxylic acid (CAS 1802154-58-0) is a chemical compound with the molecular formula C11H6BrFO2 and a molecular weight of 269.07 g/mol. IUPAC name: 4-bromo-1-fluoronaphthalene-2-carboxylic acid. InChIKey: BRLKZNNEDKVYAT-UHFFFAOYSA-N.
| Molecular formula | C11H6BrFO2 |
|---|---|
| Molecular weight | 269.07 g/mol |
| IUPAC name | 4-bromo-1-fluoronaphthalene-2-carboxylic acid |
| InChIKey | BRLKZNNEDKVYAT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=C2F)C(=O)O)Br |
Computed by PubChem (NCBI)